C38H43NO7SSi — CID 70224024
(2R,3R,5S,6R)-3-[2-[1-(benzenesulfonyl)indol-3-yl]ethyl]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxane-2,3,5-triol (PubChem CID 70224024) has the molecular formula C38H43NO7SSi and a molecular weight of 685.92 g/mol. Its IUPAC name is (2R,3R,5S,6R)-3-[2-[1-(benzenesulfonyl)indol-3-yl]ethyl]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxane-2,3,5-triol.
| Compound Name | (2R,3R,5S,6R)-3-[2-[1-(benzenesulfonyl)indol-3-yl]ethyl]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxane-2,3,5-triol |
|---|---|
| PubChem CID | 70224024 |
| Molecular Formula | C38H43NO7SSi |
| Molecular Weight | 685.92 g/mol |
| Exact Mass | 685.25 |
| IUPAC Name | (2R,3R,5S,6R)-3-[2-[1-(benzenesulfonyl)indol-3-yl]ethyl]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxane-2,3,5-triol |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H](O)[C@@](O)(CCc2cn(S(=O)(=O)c3ccccc3)c3ccccc23)C[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H43NO7SSi/c1-37(2,3)48(30-17-9-5-10-18-30,31-19-11-6-12-20-31)45-27-35-34(40)25-38(42,36(41)46-35)24-23-28-26-39(33-22-14-13-21-32(28)33)47(43,44)29-15-7-4-8-16-29/h4-22,26,34-36,40-42H,23-25,27H2,1-3H3/t34-,35+,36+,38+/m0/s1 |
| InChIKey | GAPSGOUSXXBINL-OSSKGYPSSA-N |
| XLogP | 4.59 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.92 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|