C41H46N4O8S — CID 10818871
(2S,3R,4S,5S,6S)-6-(5-azidopentoxymethyl)-2-[2-[1-(benzenesulfonyl)indol-3-yl]ethoxy]-4,5-bis(phenylmethoxy)oxan-3-ol (PubChem CID 10818871) has the molecular formula C41H46N4O8S and a molecular weight of 754.91 g/mol. Its IUPAC name is (2S,3R,4S,5S,6S)-6-(5-azidopentoxymethyl)-2-[2-[1-(benzenesulfonyl)indol-3-yl]ethoxy]-4,5-bis(phenylmethoxy)oxan-3-ol.
| Compound Name | (2S,3R,4S,5S,6S)-6-(5-azidopentoxymethyl)-2-[2-[1-(benzenesulfonyl)indol-3-yl]ethoxy]-4,5-bis(phenylmethoxy)oxan-3-ol |
|---|---|
| PubChem CID | 10818871 |
| Molecular Formula | C41H46N4O8S |
| Molecular Weight | 754.91 g/mol |
| Exact Mass | 754.30 |
| IUPAC Name | (2S,3R,4S,5S,6S)-6-(5-azidopentoxymethyl)-2-[2-[1-(benzenesulfonyl)indol-3-yl]ethoxy]-4,5-bis(phenylmethoxy)oxan-3-ol |
| SMILES | [N-]=[N+]=NCCCCCOC[C@@H]1O[C@H](OCCc2cn(S(=O)(=O)c3ccccc3)c3ccccc23)[C@H](O)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H46N4O8S/c42-44-43-24-13-4-14-25-49-30-37-39(51-28-31-15-5-1-6-16-31)40(52-29-32-17-7-2-8-18-32)38(46)41(53-37)50-26-23-33-27-45(36-22-12-11-21-35(33)36)54(47,48)34-19-9-3-10-20-34/h1-3,5-12,15-22,27,37-41,46H,4,13-14,23-26,28-30H2/t37-,38+,39-,40-,41-/m0/s1 |
| InChIKey | SXAYJFFVLZMVHB-KTKYAAHISA-N |
| XLogP | 7.19 |
| TPSA | 154.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.91 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|