C35H42O7 — CID 101471683
4-[2-[(2S,3R,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethyl]cyclohexan-1-one (PubChem CID 101471683) has the molecular formula C35H42O7 and a molecular weight of 574.71 g/mol. Its IUPAC name is 4-[2-[(2S,3R,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethyl]cyclohexan-1-one.
| Compound Name | 4-[2-[(2S,3R,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 101471683 |
| Molecular Formula | C35H42O7 |
| Molecular Weight | 574.71 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | 4-[2-[(2S,3R,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethyl]cyclohexan-1-one |
| SMILES | O=C1CCC(CCO[C@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2O)CC1 |
| InChI | InChI=1S/C35H42O7/c36-30-18-16-26(17-19-30)20-21-39-35-32(37)34(41-24-29-14-8-3-9-15-29)33(40-23-28-12-6-2-7-13-28)31(42-35)25-38-22-27-10-4-1-5-11-27/h1-15,26,31-35,37H,16-25H2/t31-,32-,33-,34-,35+/m1/s1 |
| InChIKey | XRNOWFIQNAOXRW-JSMUHSIHSA-N |
| XLogP | 5.63 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.71 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |