C47H53N3O8S — CID 10941827
5-[[(2R,3R,4S,5R,6R)-6-[2-[1-(benzenesulfonyl)indol-3-yl]ethoxy]-4,5-bis(phenylmethoxy)-3-(pyridin-4-ylmethoxy)oxan-2-yl]methoxy]pentan-1-amine (PubChem CID 10941827) has the molecular formula C47H53N3O8S and a molecular weight of 820.02 g/mol. Its IUPAC name is 5-[[(2R,3R,4S,5R,6R)-6-[2-[1-(benzenesulfonyl)indol-3-yl]ethoxy]-4,5-bis(phenylmethoxy)-3-(pyridin-4-ylmethoxy)oxan-2-yl]methoxy]pentan-1-amine.
| Compound Name | 5-[[(2R,3R,4S,5R,6R)-6-[2-[1-(benzenesulfonyl)indol-3-yl]ethoxy]-4,5-bis(phenylmethoxy)-3-(pyridin-4-ylmethoxy)oxan-2-yl]methoxy]pentan-1-amine |
|---|---|
| PubChem CID | 10941827 |
| Molecular Formula | C47H53N3O8S |
| Molecular Weight | 820.02 g/mol |
| Exact Mass | 819.36 |
| IUPAC Name | 5-[[(2R,3R,4S,5R,6R)-6-[2-[1-(benzenesulfonyl)indol-3-yl]ethoxy]-4,5-bis(phenylmethoxy)-3-(pyridin-4-ylmethoxy)oxan-2-yl]methoxy]pentan-1-amine |
| SMILES | NCCCCCOC[C@H]1O[C@@H](OCCc2cn(S(=O)(=O)c3ccccc3)c3ccccc23)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccncc1 |
| InChI | InChI=1S/C47H53N3O8S/c48-26-13-4-14-29-53-35-43-44(55-34-38-23-27-49-28-24-38)45(56-32-36-15-5-1-6-16-36)46(57-33-37-17-7-2-8-18-37)47(58-43)54-30-25-39-31-50(42-22-12-11-21-41(39)42)59(51,52)40-19-9-3-10-20-40/h1-3,5-12,15-24,27-28,31,43-47H,4,13-14,25-26,29-30,32-35,48H2/t43-,44-,45+,46-,47-/m1/s1 |
| InChIKey | CXCZGCICLRBDDV-ZTQXLAMASA-N |
| XLogP | 7.46 |
| TPSA | 133.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.02 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|