C32H40N4O6 — CID 11082409
3-[[(2R,3R,4S,5R,6R)-2-(5-azidopentoxymethyl)-6-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl]oxymethyl]pyridine (PubChem CID 11082409) has the molecular formula C32H40N4O6 and a molecular weight of 576.69 g/mol. Its IUPAC name is 3-[[(2R,3R,4S,5R,6R)-2-(5-azidopentoxymethyl)-6-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl]oxymethyl]pyridine.
| Compound Name | 3-[[(2R,3R,4S,5R,6R)-2-(5-azidopentoxymethyl)-6-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl]oxymethyl]pyridine |
|---|---|
| PubChem CID | 11082409 |
| Molecular Formula | C32H40N4O6 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | 3-[[(2R,3R,4S,5R,6R)-2-(5-azidopentoxymethyl)-6-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl]oxymethyl]pyridine |
| SMILES | CO[C@@H]1O[C@H](COCCCCCN=[N+]=[N-])[C@@H](OCc2cccnc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H40N4O6/c1-37-32-31(41-22-26-14-7-3-8-15-26)30(40-21-25-12-5-2-6-13-25)29(39-23-27-16-11-17-34-20-27)28(42-32)24-38-19-10-4-9-18-35-36-33/h2-3,5-8,11-17,20,28-32H,4,9-10,18-19,21-24H2,1H3/t28-,29-,30+,31-,32-/m1/s1 |
| InChIKey | FPLXWSYTDFMUNJ-HXBJCGEWSA-N |
| XLogP | 6.01 |
| TPSA | 117.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|