C18H36O10S — CID 146588314
3-[2,3,5-tris(2-hydroxyethoxy)-6-[2-(sulfanylmethoxy)ethoxymethyl]oxan-4-yl]propan-1-ol (PubChem CID 146588314) has the molecular formula C18H36O10S and a molecular weight of 444.54 g/mol. Its IUPAC name is 3-[2,3,5-tris(2-hydroxyethoxy)-6-[2-(sulfanylmethoxy)ethoxymethyl]oxan-4-yl]propan-1-ol.
| Compound Name | 3-[2,3,5-tris(2-hydroxyethoxy)-6-[2-(sulfanylmethoxy)ethoxymethyl]oxan-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 146588314 |
| Molecular Formula | C18H36O10S |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 3-[2,3,5-tris(2-hydroxyethoxy)-6-[2-(sulfanylmethoxy)ethoxymethyl]oxan-4-yl]propan-1-ol |
| SMILES | OCCCC1C(OCCO)C(COCCOCS)OC(OCCO)C1OCCO |
| InChI | InChI=1S/C18H36O10S/c19-3-1-2-14-16(25-7-4-20)15(12-23-10-11-24-13-29)28-18(27-9-6-22)17(14)26-8-5-21/h14-22,29H,1-13H2 |
| InChIKey | JICRBMNFXBEVLF-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|