C9H19NO3 — CID 163469681
(3R,6R)-5-amino-2-ethyl-6-methoxy-3-methyloxan-4-ol (PubChem CID 163469681) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is (3R,6R)-5-amino-2-ethyl-6-methoxy-3-methyloxan-4-ol.
| Compound Name | (3R,6R)-5-amino-2-ethyl-6-methoxy-3-methyloxan-4-ol |
|---|---|
| PubChem CID | 163469681 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | (3R,6R)-5-amino-2-ethyl-6-methoxy-3-methyloxan-4-ol |
| SMILES | CCC1O[C@@H](OC)C(N)C(O)[C@H]1C |
| InChI | InChI=1S/C9H19NO3/c1-4-6-5(2)8(11)7(10)9(12-3)13-6/h5-9,11H,4,10H2,1-3H3/t5-,6?,7?,8?,9+/m0/s1 |
| InChIKey | BVNKPWGWSOTRPL-GTSBWKHXSA-N |
| XLogP | 0.09 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |