C15H29BN2O4 — CID 157153816
CID 157153816 (PubChem CID 157153816) has the molecular formula C15H29BN2O4 and a molecular weight of 313.23 g/mol.
| Compound Name | CID 157153816 |
|---|---|
| PubChem CID | 157153816 |
| Molecular Formula | C15H29BN2O4 |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | — |
| SMILES | [2H][C@@H]1C(CO[C@@H]2OC(CC)[C@@H](C)[C@H](O)C2N)O[C@H]([B])C(N)[C@H]1C |
| InChI | InChI=1S/C15H29BN2O4/c1-4-10-8(3)13(19)12(18)15(22-10)20-6-9-5-7(2)11(17)14(16)21-9/h7-15,19H,4-6,17-18H2,1-3H3/t7-,8+,9?,10?,11?,12?,13-,14-,15+/m0/s1/i5D/t5-,7-,8+,9?,10?,11?,12?,13-,14-,15+ |
| InChIKey | JFLMCWVQGPPGQU-MHGFULKISA-N |
| XLogP | -0.29 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|