C11H23NO4 — CID 155117279
5-amino-2-(hydroxymethyl)-3-methyl-6-[(2-methylpropan-2-yl)oxy]oxan-4-ol (PubChem CID 155117279) has the molecular formula C11H23NO4 and a molecular weight of 233.31 g/mol. Its IUPAC name is 5-amino-2-(hydroxymethyl)-3-methyl-6-[(2-methylpropan-2-yl)oxy]oxan-4-ol.
| Compound Name | 5-amino-2-(hydroxymethyl)-3-methyl-6-[(2-methylpropan-2-yl)oxy]oxan-4-ol |
|---|---|
| PubChem CID | 155117279 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 5-amino-2-(hydroxymethyl)-3-methyl-6-[(2-methylpropan-2-yl)oxy]oxan-4-ol |
| SMILES | CC1C(CO)OC(OC(C)(C)C)C(N)C1O |
| InChI | InChI=1S/C11H23NO4/c1-6-7(5-13)15-10(8(12)9(6)14)16-11(2,3)4/h6-10,13-14H,5,12H2,1-4H3 |
| InChIKey | CJYJNBDJSUQNPX-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |