C33H78O11Si7 — CID 170452869
[3,4,5-tris(trimethylsilyloxy)-6-[4,5,6-tris(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methanol (PubChem CID 170452869) has the molecular formula C33H78O11Si7 and a molecular weight of 847.58 g/mol. Its IUPAC name is [3,4,5-tris(trimethylsilyloxy)-6-[4,5,6-tris(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methanol.
| Compound Name | [3,4,5-tris(trimethylsilyloxy)-6-[4,5,6-tris(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methanol |
|---|---|
| PubChem CID | 170452869 |
| Molecular Formula | C33H78O11Si7 |
| Molecular Weight | 847.58 g/mol |
| Exact Mass | 846.39 |
| IUPAC Name | [3,4,5-tris(trimethylsilyloxy)-6-[4,5,6-tris(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methanol |
| SMILES | C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C33H78O11Si7/c1-45(2,3)35-23-25-26(28(40-47(7,8)9)31(43-50(16,17)18)33(37-25)44-51(19,20)21)38-32-30(42-49(13,14)15)29(41-48(10,11)12)27(24(22-34)36-32)39-46(4,5)6/h24-34H,22-23H2,1-21H3 |
| InChIKey | FRLMJXBBRQVLKS-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.58 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|