C30H70O11Si6 — CID 135021954
[(3R,6R)-6-[(2R,5R)-6-(hydroxymethyl)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]oxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methanol (PubChem CID 135021954) has the molecular formula C30H70O11Si6 and a molecular weight of 775.39 g/mol. Its IUPAC name is [(3R,6R)-6-[(2R,5R)-6-(hydroxymethyl)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]oxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methanol.
| Compound Name | [(3R,6R)-6-[(2R,5R)-6-(hydroxymethyl)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]oxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 135021954 |
| Molecular Formula | C30H70O11Si6 |
| Molecular Weight | 775.39 g/mol |
| Exact Mass | 774.35 |
| IUPAC Name | [(3R,6R)-6-[(2R,5R)-6-(hydroxymethyl)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]oxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methanol |
| SMILES | C[Si](C)(C)OC1C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(CO)O[C@@H]1O[C@H]1OC(CO)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C30H70O11Si6/c1-42(2,3)36-23-21(19-31)33-29(27(40-46(13,14)15)25(23)38-44(7,8)9)35-30-28(41-47(16,17)18)26(39-45(10,11)12)24(22(20-32)34-30)37-43(4,5)6/h21-32H,19-20H2,1-18H3/t21?,22?,23-,24-,25?,26?,27?,28?,29-,30-/m1/s1 |
| InChIKey | GJRIVRWJCNTRRI-GUIULOMPSA-N |
| XLogP | 5.76 |
| TPSA | 123.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.39 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|