C5H10O6 — CID 129307305
(2R,5S)-6-(hydroxymethyl)-1,4-dioxane-2,3,5-triol (PubChem CID 129307305) has the molecular formula C5H10O6 and a molecular weight of 166.13 g/mol. Its IUPAC name is (2R,5S)-6-(hydroxymethyl)-1,4-dioxane-2,3,5-triol.
| Compound Name | (2R,5S)-6-(hydroxymethyl)-1,4-dioxane-2,3,5-triol |
|---|---|
| PubChem CID | 129307305 |
| Molecular Formula | C5H10O6 |
| Molecular Weight | 166.13 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | (2R,5S)-6-(hydroxymethyl)-1,4-dioxane-2,3,5-triol |
| SMILES | OCC1O[C@@H](O)C(O)O[C@@H]1O |
| InChI | InChI=1S/C5H10O6/c6-1-2-3(7)11-5(9)4(8)10-2/h2-9H,1H2/t2?,3-,4+,5?/m0/s1 |
| InChIKey | MRUPZIDJEFHVHM-KGIDARAMSA-N |
| XLogP | -2.65 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.13 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |