C7H12O5 — CID 102017861
(1R,2R,4S,5R,6S)-2-(hydroxymethyl)-4-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-ol (PubChem CID 102017861) has the molecular formula C7H12O5 and a molecular weight of 176.17 g/mol. Its IUPAC name is (1R,2R,4S,5R,6S)-2-(hydroxymethyl)-4-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-ol.
| Compound Name | (1R,2R,4S,5R,6S)-2-(hydroxymethyl)-4-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-ol |
|---|---|
| PubChem CID | 102017861 |
| Molecular Formula | C7H12O5 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | (1R,2R,4S,5R,6S)-2-(hydroxymethyl)-4-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-ol |
| SMILES | CO[C@H]1O[C@H](CO)[C@H]2O[C@H]2[C@H]1O |
| InChI | InChI=1S/C7H12O5/c1-10-7-4(9)6-5(12-6)3(2-8)11-7/h3-9H,2H2,1H3/t3-,4-,5-,6+,7+/m1/s1 |
| InChIKey | RMWRLUMRRZLOGH-OVHBTUCOSA-N |
| XLogP | -1.52 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|