C9H14O4 — CID 130361222
(1S,3R,5S,6S,8R,9S,10R)-9,10-dimethyl-2,4,7-trioxatricyclo[4.3.1.03,8]decan-5-ol (PubChem CID 130361222) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is (1S,3R,5S,6S,8R,9S,10R)-9,10-dimethyl-2,4,7-trioxatricyclo[4.3.1.03,8]decan-5-ol.
| Compound Name | (1S,3R,5S,6S,8R,9S,10R)-9,10-dimethyl-2,4,7-trioxatricyclo[4.3.1.03,8]decan-5-ol |
|---|---|
| PubChem CID | 130361222 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | (1S,3R,5S,6S,8R,9S,10R)-9,10-dimethyl-2,4,7-trioxatricyclo[4.3.1.03,8]decan-5-ol |
| SMILES | C[C@@H]1[C@@H]2O[C@@H]3O[C@H](O)[C@H]1O[C@@H]3[C@H]2C |
| InChI | InChI=1S/C9H14O4/c1-3-5-4(2)7-9(12-5)13-8(10)6(3)11-7/h3-10H,1-2H3/t3-,4+,5+,6+,7-,8+,9-/m1/s1 |
| InChIKey | YJUSANWBOKNCFT-JRPWLHHSSA-N |
| XLogP | 0.10 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |