C10H14O3 — CID 135193122
(1S,3R,6S,8R,9S,10R)-9,10-dimethyl-5-methylidene-2,4,7-trioxatricyclo[4.3.1.03,8]decane (PubChem CID 135193122) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is (1S,3R,6S,8R,9S,10R)-9,10-dimethyl-5-methylidene-2,4,7-trioxatricyclo[4.3.1.03,8]decane.
| Compound Name | (1S,3R,6S,8R,9S,10R)-9,10-dimethyl-5-methylidene-2,4,7-trioxatricyclo[4.3.1.03,8]decane |
|---|---|
| PubChem CID | 135193122 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (1S,3R,6S,8R,9S,10R)-9,10-dimethyl-5-methylidene-2,4,7-trioxatricyclo[4.3.1.03,8]decane |
| SMILES | C=C1O[C@H]2O[C@H]3[C@@H](C)[C@@H]1O[C@@H]2[C@H]3C |
| InChI | InChI=1S/C10H14O3/c1-4-7-5(2)9-10(13-7)11-6(3)8(4)12-9/h4-5,7-10H,3H2,1-2H3/t4-,5+,7+,8+,9-,10+/m1/s1 |
| InChIKey | NEYNYCILPPXKTD-VFLGHHOZSA-N |
| XLogP | 1.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |