C7H13NO — CID 89103186
(3R,4R)-4,5-dimethyl-2-methylideneoxolan-3-amine (PubChem CID 89103186) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is (3R,4R)-4,5-dimethyl-2-methylideneoxolan-3-amine.
| Compound Name | (3R,4R)-4,5-dimethyl-2-methylideneoxolan-3-amine |
|---|---|
| PubChem CID | 89103186 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | (3R,4R)-4,5-dimethyl-2-methylideneoxolan-3-amine |
| SMILES | C=C1OC(C)[C@H](C)[C@H]1N |
| InChI | InChI=1S/C7H13NO/c1-4-5(2)9-6(3)7(4)8/h4-5,7H,3,8H2,1-2H3/t4-,5?,7+/m0/s1 |
| InChIKey | DUNLAVRKARKPII-RMIHLSNLSA-N |
| XLogP | 0.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |