About 3-butoxy-5-methylhepta-1,2-dien-4-amine
3-butoxy-5-methylhepta-1,2-dien-4-amine (PubChem CID 139394807) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is 3-butoxy-5-methylhepta-1,2-dien-4-amine.
Molecular Properties
| Compound Name | 3-butoxy-5-methylhepta-1,2-dien-4-amine |
| PubChem CID | 139394807 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 3-butoxy-5-methylhepta-1,2-dien-4-amine |
| SMILES | C=C=C(OCCCC)C(N)C(C)CC |
| InChI | InChI=1S/C12H23NO/c1-5-8-9-14-11(7-3)12(13)10(4)6-2/h10,12H,3,5-6,8-9,13H2,1-2,4H3 |
| InChIKey | CZKZWQUHHNLYLH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxy-5-methylhepta-1,2-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxy-5-methylhepta-1,2-dien-4-amine?
The IUPAC name of 3-butoxy-5-methylhepta-1,2-dien-4-amine (CID 139394807) is 3-butoxy-5-methylhepta-1,2-dien-4-amine.
What is the SMILES notation for 3-butoxy-5-methylhepta-1,2-dien-4-amine?
The canonical SMILES for 3-butoxy-5-methylhepta-1,2-dien-4-amine is C=C=C(OCCCC)C(N)C(C)CC.
What is the InChIKey of 3-butoxy-5-methylhepta-1,2-dien-4-amine?
The InChIKey is CZKZWQUHHNLYLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c1-5-8-9-14-11(7-3)12(13)10(4)6-2/h10,12H,3,5-6,8-9,13H2,1-2,4H3.
What are the key properties of 3-butoxy-5-methylhepta-1,2-dien-4-amine?
3-butoxy-5-methylhepta-1,2-dien-4-amine has a molecular weight of 197.32 g/mol, XLogP of 2.85, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxy-5-methylhepta-1,2-dien-4-amine is sourced from PubChem (CID 139394807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).