C16H28O6 — CID 166083295
2-tert-butyl-5-(2-tert-butyl-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 166083295) has the molecular formula C16H28O6 and a molecular weight of 316.39 g/mol. Its IUPAC name is 2-tert-butyl-5-(2-tert-butyl-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | 2-tert-butyl-5-(2-tert-butyl-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 166083295 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 2-tert-butyl-5-(2-tert-butyl-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC(C)(C)C1OCC(C2OC3OC(C(C)(C)C)OC3C2O)O1 |
| InChI | InChI=1S/C16H28O6/c1-15(2,3)13-18-7-8(19-13)10-9(17)11-12(20-10)22-14(21-11)16(4,5)6/h8-14,17H,7H2,1-6H3 |
| InChIKey | XSOVHLLMLQDLQU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |