About (2R,4R)-2-tert-butyl-4-methyl-1,3-dioxolane
(2R,4R)-2-tert-butyl-4-methyl-1,3-dioxolane (PubChem CID 170847914) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is (2R,4R)-2-tert-butyl-4-methyl-1,3-dioxolane.
Molecular Properties
| Compound Name | (2R,4R)-2-tert-butyl-4-methyl-1,3-dioxolane |
| PubChem CID | 170847914 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | (2R,4R)-2-tert-butyl-4-methyl-1,3-dioxolane |
| SMILES | C[C@@H]1CO[C@@H](C(C)(C)C)O1 |
| InChI | InChI=1S/C8H16O2/c1-6-5-9-7(10-6)8(2,3)4/h6-7H,5H2,1-4H3/t6-,7-/m1/s1 |
| InChIKey | HXZAHJCDQZCFMZ-RNFRBKRXSA-N |
| XLogP | 1.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,4R)-2-tert-butyl-4-methyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4R)-2-tert-butyl-4-methyl-1,3-dioxolane?
The IUPAC name of (2R,4R)-2-tert-butyl-4-methyl-1,3-dioxolane (CID 170847914) is (2R,4R)-2-tert-butyl-4-methyl-1,3-dioxolane.
What is the SMILES notation for (2R,4R)-2-tert-butyl-4-methyl-1,3-dioxolane?
The canonical SMILES for (2R,4R)-2-tert-butyl-4-methyl-1,3-dioxolane is C[C@@H]1CO[C@@H](C(C)(C)C)O1.
What is the InChIKey of (2R,4R)-2-tert-butyl-4-methyl-1,3-dioxolane?
The InChIKey is HXZAHJCDQZCFMZ-RNFRBKRXSA-N. The full InChI is InChI=1S/C8H16O2/c1-6-5-9-7(10-6)8(2,3)4/h6-7H,5H2,1-4H3/t6-,7-/m1/s1.
What are the key properties of (2R,4R)-2-tert-butyl-4-methyl-1,3-dioxolane?
(2R,4R)-2-tert-butyl-4-methyl-1,3-dioxolane has a molecular weight of 144.21 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4R)-2-tert-butyl-4-methyl-1,3-dioxolane is sourced from PubChem (CID 170847914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).