C6H8Cl2O3 — CID 130847537
(1R,2R,3S,4S,5R)-2,3-dichloro-6,8-dioxabicyclo[3.2.1]octan-4-ol (PubChem CID 130847537) has the molecular formula C6H8Cl2O3 and a molecular weight of 199.03 g/mol. Its IUPAC name is (1R,2R,3S,4S,5R)-2,3-dichloro-6,8-dioxabicyclo[3.2.1]octan-4-ol.
| Compound Name | (1R,2R,3S,4S,5R)-2,3-dichloro-6,8-dioxabicyclo[3.2.1]octan-4-ol |
|---|---|
| PubChem CID | 130847537 |
| Molecular Formula | C6H8Cl2O3 |
| Molecular Weight | 199.03 g/mol |
| Exact Mass | 197.99 |
| IUPAC Name | (1R,2R,3S,4S,5R)-2,3-dichloro-6,8-dioxabicyclo[3.2.1]octan-4-ol |
| SMILES | O[C@H]1[C@@H]2OC[C@@H](O2)[C@@H](Cl)[C@H]1Cl |
| InChI | InChI=1S/C6H8Cl2O3/c7-3-2-1-10-6(11-2)5(9)4(3)8/h2-6,9H,1H2/t2-,3-,4-,5-,6-/m1/s1 |
| InChIKey | QAMKFZXQFHQFJE-QZABAPFNSA-N |
| XLogP | 0.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.03 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|