C6H9IO4 — CID 126969579
(1R,2S,3R,4S,5R)-4-iodo-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (PubChem CID 126969579) has the molecular formula C6H9IO4 and a molecular weight of 272.04 g/mol. Its IUPAC name is (1R,2S,3R,4S,5R)-4-iodo-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
| Compound Name | (1R,2S,3R,4S,5R)-4-iodo-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
|---|---|
| PubChem CID | 126969579 |
| Molecular Formula | C6H9IO4 |
| Molecular Weight | 272.04 g/mol |
| Exact Mass | 271.95 |
| IUPAC Name | (1R,2S,3R,4S,5R)-4-iodo-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| SMILES | O[C@@H]1[C@H](O)[C@H]2CO[C@H](O2)[C@H]1I |
| InChI | InChI=1S/C6H9IO4/c7-3-5(9)4(8)2-1-10-6(3)11-2/h2-6,8-9H,1H2/t2-,3+,4-,5+,6-/m1/s1 |
| InChIKey | SWUJNWULTXIUBD-FDROIEKHSA-N |
| XLogP | -0.73 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.04 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|