C10H9FN2O7 — CID 23261448
1-[(2R,3R,3aR,6S,6aR)-3,6-dihydroxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-2-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 23261448) has the molecular formula C10H9FN2O7 and a molecular weight of 288.19 g/mol. Its IUPAC name is 1-[(2R,3R,3aR,6S,6aR)-3,6-dihydroxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-2-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,3aR,6S,6aR)-3,6-dihydroxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-2-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 23261448 |
| Molecular Formula | C10H9FN2O7 |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 1-[(2R,3R,3aR,6S,6aR)-3,6-dihydroxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-2-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | O=C1O[C@@H]2[C@@H](O)[C@H](n3cc(F)c(=O)[nH]c3=O)O[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C10H9FN2O7/c11-2-1-13(10(18)12-7(2)16)8-3(14)5-6(19-8)4(15)9(17)20-5/h1,3-6,8,14-15H,(H,12,16,18)/t3-,4+,5-,6-,8-/m1/s1 |
| InChIKey | LYTHELIUVFAGBH-KYRVAOBLSA-N |
| XLogP | -2.78 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |