C11H16FN3O7 — CID 67362589
2-aminoacetic acid;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 67362589) has the molecular formula C11H16FN3O7 and a molecular weight of 321.26 g/mol. Its IUPAC name is 2-aminoacetic acid;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 2-aminoacetic acid;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67362589 |
| Molecular Formula | C11H16FN3O7 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-aminoacetic acid;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | C[C@H]1O[C@@H](n2cc(F)c(=O)[nH]c2=O)[C@H](O)[C@@H]1O.NCC(=O)O |
| InChI | InChI=1S/C9H11FN2O5.C2H5NO2/c1-3-5(13)6(14)8(17-3)12-2-4(10)7(15)11-9(12)16;3-1-2(4)5/h2-3,5-6,8,13-14H,1H3,(H,11,15,16);1,3H2,(H,4,5)/t3-,5-,6-,8-;/m1./s1 |
| InChIKey | AKOJRARPHAVOND-URXMEGBKSA-N |
| XLogP | -2.66 |
| TPSA | 167.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |