C15H25FN4O7 — CID 67365413
2,6-diaminohexanoic acid;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 67365413) has the molecular formula C15H25FN4O7 and a molecular weight of 392.38 g/mol. Its IUPAC name is 2,6-diaminohexanoic acid;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 2,6-diaminohexanoic acid;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67365413 |
| Molecular Formula | C15H25FN4O7 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2,6-diaminohexanoic acid;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | C[C@H]1O[C@@H](n2cc(F)c(=O)[nH]c2=O)[C@H](O)[C@@H]1O.NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C9H11FN2O5.C6H14N2O2/c1-3-5(13)6(14)8(17-3)12-2-4(10)7(15)11-9(12)16;7-4-2-1-3-5(8)6(9)10/h2-3,5-6,8,13-14H,1H3,(H,11,15,16);5H,1-4,7-8H2,(H,9,10)/t3-,5-,6-,8-;/m1./s1 |
| InChIKey | ONUYIMCFNQQHSY-URXMEGBKSA-N |
| XLogP | -2.16 |
| TPSA | 193.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|