C6H8O5 — CID 130926096
(4aR,7R,7aR)-7-hydroxy-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one (PubChem CID 130926096) has the molecular formula C6H8O5 and a molecular weight of 160.12 g/mol. Its IUPAC name is (4aR,7R,7aR)-7-hydroxy-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one.
| Compound Name | (4aR,7R,7aR)-7-hydroxy-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one |
|---|---|
| PubChem CID | 130926096 |
| Molecular Formula | C6H8O5 |
| Molecular Weight | 160.12 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | (4aR,7R,7aR)-7-hydroxy-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one |
| SMILES | O=C1O[C@@H]2COCO[C@@H]2[C@H]1O |
| InChI | InChI=1S/C6H8O5/c7-4-5-3(11-6(4)8)1-9-2-10-5/h3-5,7H,1-2H2/t3-,4-,5+/m1/s1 |
| InChIKey | XSYGLASFMMSHFU-WDCZJNDASA-N |
| XLogP | -1.35 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.12 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |