About 4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one
4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one (PubChem CID 141190397) has the molecular formula C6H8O4
and a molecular weight of 144.13 g/mol. Its IUPAC name is 4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one.
Analyze 4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one?
The IUPAC name of 4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one (CID 141190397) is 4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one.
What is the SMILES notation for 4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one?
The canonical SMILES for 4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one is O=C1CC2OCOCC2O1.
What is the InChIKey of 4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one?
The InChIKey is DYZKXEJHHMYXHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O4/c7-6-1-4-5(10-6)2-8-3-9-4/h4-5H,1-3H2.
What are the key properties of 4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one?
4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one has a molecular weight of 144.13 g/mol, XLogP of -0.33, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one is sourced from PubChem (CID 141190397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).