C17H16O6 — CID 71712789
(3aR,4S,5R,7R,9bR)-4,5-dihydroxy-7-phenyl-3a,4,5,7,8,9b-hexahydro-1H-furo[3,2-f]chromene-2,9-dione (PubChem CID 71712789) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is (3aR,4S,5R,7R,9bR)-4,5-dihydroxy-7-phenyl-3a,4,5,7,8,9b-hexahydro-1H-furo[3,2-f]chromene-2,9-dione.
| Compound Name | (3aR,4S,5R,7R,9bR)-4,5-dihydroxy-7-phenyl-3a,4,5,7,8,9b-hexahydro-1H-furo[3,2-f]chromene-2,9-dione |
|---|---|
| PubChem CID | 71712789 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (3aR,4S,5R,7R,9bR)-4,5-dihydroxy-7-phenyl-3a,4,5,7,8,9b-hexahydro-1H-furo[3,2-f]chromene-2,9-dione |
| SMILES | O=C1C[C@@H]2C3=C(O[C@@H](c4ccccc4)CC3=O)[C@H](O)[C@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C17H16O6/c18-10-7-11(8-4-2-1-3-5-8)22-17-13(10)9-6-12(19)23-16(9)14(20)15(17)21/h1-5,9,11,14-16,20-21H,6-7H2/t9-,11-,14+,15-,16-/m1/s1 |
| InChIKey | KAOUCQHQSAFJNU-YEIZZHLNSA-N |
| XLogP | 0.64 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |