C9H9BrO — CID 58169778
5-bromo-1,3,3a,7a-tetrahydroinden-2-one (PubChem CID 58169778) has the molecular formula C9H9BrO and a molecular weight of 213.07 g/mol. Its IUPAC name is 5-bromo-1,3,3a,7a-tetrahydroinden-2-one.
| Compound Name | 5-bromo-1,3,3a,7a-tetrahydroinden-2-one |
|---|---|
| PubChem CID | 58169778 |
| Molecular Formula | C9H9BrO |
| Molecular Weight | 213.07 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | 5-bromo-1,3,3a,7a-tetrahydroinden-2-one |
| SMILES | O=C1CC2C=CC(Br)=CC2C1 |
| InChI | InChI=1S/C9H9BrO/c10-8-2-1-6-4-9(11)5-7(6)3-8/h1-3,6-7H,4-5H2 |
| InChIKey | RPSXRIYBZJICKJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.07 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |