C14H21Br — CID 142949508
6-bromo-1,1,4,4-tetramethyl-2,3,4a,8a-tetrahydronaphthalene (PubChem CID 142949508) has the molecular formula C14H21Br and a molecular weight of 269.23 g/mol. Its IUPAC name is 6-bromo-1,1,4,4-tetramethyl-2,3,4a,8a-tetrahydronaphthalene.
| Compound Name | 6-bromo-1,1,4,4-tetramethyl-2,3,4a,8a-tetrahydronaphthalene |
|---|---|
| PubChem CID | 142949508 |
| Molecular Formula | C14H21Br |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 6-bromo-1,1,4,4-tetramethyl-2,3,4a,8a-tetrahydronaphthalene |
| SMILES | CC1(C)CCC(C)(C)C2C=C(Br)C=CC21 |
| InChI | InChI=1S/C14H21Br/c1-13(2)7-8-14(3,4)12-9-10(15)5-6-11(12)13/h5-6,9,11-12H,7-8H2,1-4H3 |
| InChIKey | YWZUMBWSIUOARJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |