C16H26 — CID 11241437
(4aS,6S,9aR)-2,6,9,9-tetramethyl-5-methylidene-4,4a,6,7,8,9a-hexahydro-3H-benzo[7]annulene (PubChem CID 11241437) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is (4aS,6S,9aR)-2,6,9,9-tetramethyl-5-methylidene-4,4a,6,7,8,9a-hexahydro-3H-benzo[7]annulene.
| Compound Name | (4aS,6S,9aR)-2,6,9,9-tetramethyl-5-methylidene-4,4a,6,7,8,9a-hexahydro-3H-benzo[7]annulene |
|---|---|
| PubChem CID | 11241437 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | (4aS,6S,9aR)-2,6,9,9-tetramethyl-5-methylidene-4,4a,6,7,8,9a-hexahydro-3H-benzo[7]annulene |
| SMILES | C=C1[C@H]2CCC(C)=C[C@H]2C(C)(C)CC[C@@H]1C |
| InChI | InChI=1S/C16H26/c1-11-6-7-14-13(3)12(2)8-9-16(4,5)15(14)10-11/h10,12,14-15H,3,6-9H2,1-2,4-5H3/t12-,14+,15+/m0/s1 |
| InChIKey | YMCJNTJDSOESFI-NWANDNLSSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|