C12H18O — CID 10932014
(2R,4aR,8aS)-7-methyl-4-methylidene-2,3,4a,5,6,8a-hexahydro-1H-naphthalen-2-ol (PubChem CID 10932014) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (2R,4aR,8aS)-7-methyl-4-methylidene-2,3,4a,5,6,8a-hexahydro-1H-naphthalen-2-ol.
| Compound Name | (2R,4aR,8aS)-7-methyl-4-methylidene-2,3,4a,5,6,8a-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 10932014 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (2R,4aR,8aS)-7-methyl-4-methylidene-2,3,4a,5,6,8a-hexahydro-1H-naphthalen-2-ol |
| SMILES | C=C1C[C@H](O)C[C@H]2C=C(C)CC[C@@H]12 |
| InChI | InChI=1S/C12H18O/c1-8-3-4-12-9(2)6-11(13)7-10(12)5-8/h5,10-13H,2-4,6-7H2,1H3/t10-,11+,12+/m1/s1 |
| InChIKey | SYFRWXXVNPDIDF-WOPDTQHZSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|