C24H38O4 — CID 10668152
(2R)-2-[(3S,6S)-6-methyl-6-[2-(2,3,6-trimethyl-1-methylidene-3,4,4a,7,8,8a-hexahydronaphthalen-2-yl)ethyl]dioxan-3-yl]propanoic acid (PubChem CID 10668152) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is (2R)-2-[(3S,6S)-6-methyl-6-[2-(2,3,6-trimethyl-1-methylidene-3,4,4a,7,8,8a-hexahydronaphthalen-2-yl)ethyl]dioxan-3-yl]propanoic acid.
| Compound Name | (2R)-2-[(3S,6S)-6-methyl-6-[2-(2,3,6-trimethyl-1-methylidene-3,4,4a,7,8,8a-hexahydronaphthalen-2-yl)ethyl]dioxan-3-yl]propanoic acid |
|---|---|
| PubChem CID | 10668152 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | (2R)-2-[(3S,6S)-6-methyl-6-[2-(2,3,6-trimethyl-1-methylidene-3,4,4a,7,8,8a-hexahydronaphthalen-2-yl)ethyl]dioxan-3-yl]propanoic acid |
| SMILES | C=C1C2CCC(C)=CC2CC(C)C1(C)CC[C@@]1(C)CC[C@@H]([C@@H](C)C(=O)O)OO1 |
| InChI | InChI=1S/C24H38O4/c1-15-7-8-20-18(4)24(6,16(2)14-19(20)13-15)12-11-23(5)10-9-21(27-28-23)17(3)22(25)26/h13,16-17,19-21H,4,7-12,14H2,1-3,5-6H3,(H,25,26)/t16?,17-,19?,20?,21+,23-,24?/m1/s1 |
| InChIKey | LVQMPUMJUHHRPG-OMPDQGOJSA-N |
| XLogP | 5.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|