C24H42O5 — CID 74052036
2-[6-[2-(4a-hydroxy-2,5,5,8a-tetramethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-yl)ethyl]-6-methyldioxan-3-yl]propanoic acid (PubChem CID 74052036) has the molecular formula C24H42O5 and a molecular weight of 410.60 g/mol. Its IUPAC name is 2-[6-[2-(4a-hydroxy-2,5,5,8a-tetramethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-yl)ethyl]-6-methyldioxan-3-yl]propanoic acid.
| Compound Name | 2-[6-[2-(4a-hydroxy-2,5,5,8a-tetramethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-yl)ethyl]-6-methyldioxan-3-yl]propanoic acid |
|---|---|
| PubChem CID | 74052036 |
| Molecular Formula | C24H42O5 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | 2-[6-[2-(4a-hydroxy-2,5,5,8a-tetramethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-yl)ethyl]-6-methyldioxan-3-yl]propanoic acid |
| SMILES | CC1CCC2(O)C(C)(C)CCCC2(C)C1CCC1(C)CCC(C(C)C(=O)O)OO1 |
| InChI | InChI=1S/C24H42O5/c1-16-8-15-24(27)21(3,4)11-7-12-23(24,6)18(16)9-13-22(5)14-10-19(28-29-22)17(2)20(25)26/h16-19,27H,7-15H2,1-6H3,(H,25,26) |
| InChIKey | PBSILNSNUMTUJG-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|