About 5-methyl-5-[2-(2,2,6-trimethylcyclohexyl)ethyl]oxolan-2-one
5-methyl-5-[2-(2,2,6-trimethylcyclohexyl)ethyl]oxolan-2-one (PubChem CID 177002568) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is 5-methyl-5-[2-(2,2,6-trimethylcyclohexyl)ethyl]oxolan-2-one.
Molecular Properties
| Compound Name | 5-methyl-5-[2-(2,2,6-trimethylcyclohexyl)ethyl]oxolan-2-one |
| PubChem CID | 177002568 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 5-methyl-5-[2-(2,2,6-trimethylcyclohexyl)ethyl]oxolan-2-one |
| SMILES | CC1CCCC(C)(C)C1CCC1(C)CCC(=O)O1 |
| InChI | InChI=1S/C16H28O2/c1-12-6-5-9-15(2,3)13(12)7-10-16(4)11-8-14(17)18-16/h12-13H,5-11H2,1-4H3 |
| InChIKey | KOECNLLANZSWOJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-5-[2-(2,2,6-trimethylcyclohexyl)ethyl]oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-5-[2-(2,2,6-trimethylcyclohexyl)ethyl]oxolan-2-one?
The IUPAC name of 5-methyl-5-[2-(2,2,6-trimethylcyclohexyl)ethyl]oxolan-2-one (CID 177002568) is 5-methyl-5-[2-(2,2,6-trimethylcyclohexyl)ethyl]oxolan-2-one.
What is the SMILES notation for 5-methyl-5-[2-(2,2,6-trimethylcyclohexyl)ethyl]oxolan-2-one?
The canonical SMILES for 5-methyl-5-[2-(2,2,6-trimethylcyclohexyl)ethyl]oxolan-2-one is CC1CCCC(C)(C)C1CCC1(C)CCC(=O)O1.
What is the InChIKey of 5-methyl-5-[2-(2,2,6-trimethylcyclohexyl)ethyl]oxolan-2-one?
The InChIKey is KOECNLLANZSWOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O2/c1-12-6-5-9-15(2,3)13(12)7-10-16(4)11-8-14(17)18-16/h12-13H,5-11H2,1-4H3.
What are the key properties of 5-methyl-5-[2-(2,2,6-trimethylcyclohexyl)ethyl]oxolan-2-one?
5-methyl-5-[2-(2,2,6-trimethylcyclohexyl)ethyl]oxolan-2-one has a molecular weight of 252.40 g/mol, XLogP of 4.32, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-5-[2-(2,2,6-trimethylcyclohexyl)ethyl]oxolan-2-one is sourced from PubChem (CID 177002568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).