C24H40O5 — CID 75244718
2-[6-methyl-6-[4-methyl-6-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)hex-3-enyl]dioxan-3-yl]propanoic acid (PubChem CID 75244718) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is 2-[6-methyl-6-[4-methyl-6-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)hex-3-enyl]dioxan-3-yl]propanoic acid.
| Compound Name | 2-[6-methyl-6-[4-methyl-6-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)hex-3-enyl]dioxan-3-yl]propanoic acid |
|---|---|
| PubChem CID | 75244718 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 2-[6-methyl-6-[4-methyl-6-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)hex-3-enyl]dioxan-3-yl]propanoic acid |
| SMILES | CC(=CCCC1(C)CCC(C(C)C(=O)O)OO1)CCC12OC1(C)CCCC2(C)C |
| InChI | InChI=1S/C24H40O5/c1-17(10-16-24-21(3,4)12-8-14-23(24,6)28-24)9-7-13-22(5)15-11-19(27-29-22)18(2)20(25)26/h9,18-19H,7-8,10-16H2,1-6H3,(H,25,26) |
| InChIKey | ZJDQUUJWNSJRQH-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|