C31H46O4 — CID 15813841
benzyl (2S)-2-[(3S,6R)-6-methyl-6-[(E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-3-enyl]dioxan-3-yl]propanoate (PubChem CID 15813841) has the molecular formula C31H46O4 and a molecular weight of 482.71 g/mol. Its IUPAC name is benzyl (2S)-2-[(3S,6R)-6-methyl-6-[(E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-3-enyl]dioxan-3-yl]propanoate.
| Compound Name | benzyl (2S)-2-[(3S,6R)-6-methyl-6-[(E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-3-enyl]dioxan-3-yl]propanoate |
|---|---|
| PubChem CID | 15813841 |
| Molecular Formula | C31H46O4 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | benzyl (2S)-2-[(3S,6R)-6-methyl-6-[(E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-3-enyl]dioxan-3-yl]propanoate |
| SMILES | CC1=C(CC/C(C)=C/CC[C@]2(C)CC[C@@H]([C@H](C)C(=O)OCc3ccccc3)OO2)C(C)(C)CCC1 |
| InChI | InChI=1S/C31H46O4/c1-23(16-17-27-24(2)13-11-19-30(27,4)5)12-10-20-31(6)21-18-28(34-35-31)25(3)29(32)33-22-26-14-8-7-9-15-26/h7-9,12,14-15,25,28H,10-11,13,16-22H2,1-6H3/b23-12+/t25-,28-,31+/m0/s1 |
| InChIKey | UIDHZKHZBWBCMB-XOPZEBHXSA-N |
| XLogP | 8.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|