C27H38O6 — CID 163058078
[(2S)-3-[(1R,3E,7E)-4-formyl-1-hydroxy-8-methyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,7-dienyl]-5-oxo-2H-furan-2-yl] acetate (PubChem CID 163058078) has the molecular formula C27H38O6 and a molecular weight of 458.60 g/mol. Its IUPAC name is [(2S)-3-[(1R,3E,7E)-4-formyl-1-hydroxy-8-methyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,7-dienyl]-5-oxo-2H-furan-2-yl] acetate.
| Compound Name | [(2S)-3-[(1R,3E,7E)-4-formyl-1-hydroxy-8-methyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,7-dienyl]-5-oxo-2H-furan-2-yl] acetate |
|---|---|
| PubChem CID | 163058078 |
| Molecular Formula | C27H38O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | [(2S)-3-[(1R,3E,7E)-4-formyl-1-hydroxy-8-methyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,7-dienyl]-5-oxo-2H-furan-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1OC(=O)C=C1[C@H](O)C/C=C(/C=O)CC/C=C(\C)CCC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C27H38O6/c1-18(11-13-23-19(2)9-7-15-27(23,4)5)8-6-10-21(17-28)12-14-24(30)22-16-25(31)33-26(22)32-20(3)29/h8,12,16-17,24,26,30H,6-7,9-11,13-15H2,1-5H3/b18-8+,21-12+/t24-,26+/m1/s1 |
| InChIKey | PRJYGULWSUVOHQ-FCDGLQLQSA-N |
| XLogP | 5.27 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|