C21H36O — CID 167089610
(E)-9-methyl-11-(2,6,6-trimethylcyclohexen-1-yl)undec-8-en-2-one (PubChem CID 167089610) has the molecular formula C21H36O and a molecular weight of 304.52 g/mol. Its IUPAC name is (E)-9-methyl-11-(2,6,6-trimethylcyclohexen-1-yl)undec-8-en-2-one.
| Compound Name | (E)-9-methyl-11-(2,6,6-trimethylcyclohexen-1-yl)undec-8-en-2-one |
|---|---|
| PubChem CID | 167089610 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | (E)-9-methyl-11-(2,6,6-trimethylcyclohexen-1-yl)undec-8-en-2-one |
| SMILES | CC(=O)CCCCC/C=C(\C)CCC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C21H36O/c1-17(11-8-6-7-9-13-19(3)22)14-15-20-18(2)12-10-16-21(20,4)5/h11H,6-10,12-16H2,1-5H3/b17-11+ |
| InChIKey | WVXKSYMIHCFTDB-GZTJUZNOSA-N |
| XLogP | 6.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|