C40H65NO — CID 89188416
(5R)-1,3,3-trimethyl-5-nitroso-2-[(3E,7E,11E,15E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-3,7,11,15-tetraenyl]cyclohexene (PubChem CID 89188416) has the molecular formula C40H65NO and a molecular weight of 575.97 g/mol. Its IUPAC name is (5R)-1,3,3-trimethyl-5-nitroso-2-[(3E,7E,11E,15E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-3,7,11,15-tetraenyl]cyclohexene.
| Compound Name | (5R)-1,3,3-trimethyl-5-nitroso-2-[(3E,7E,11E,15E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-3,7,11,15-tetraenyl]cyclohexene |
|---|---|
| PubChem CID | 89188416 |
| Molecular Formula | C40H65NO |
| Molecular Weight | 575.97 g/mol |
| Exact Mass | 575.51 |
| IUPAC Name | (5R)-1,3,3-trimethyl-5-nitroso-2-[(3E,7E,11E,15E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-3,7,11,15-tetraenyl]cyclohexene |
| SMILES | CC1=C(CC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC2=C(C)C[C@@H](N=O)CC2(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C40H65NO/c1-30(18-13-20-32(3)23-25-37-34(5)22-15-27-39(37,7)8)16-11-12-17-31(2)19-14-21-33(4)24-26-38-35(6)28-36(41-42)29-40(38,9)10/h16-17,20-21,36H,11-15,18-19,22-29H2,1-10H3/b30-16+,31-17+,32-20+,33-21+/t36-/m1/s1 |
| InChIKey | KVBWHKVFIMDQGV-LGDCMCQYSA-N |
| XLogP | 13.47 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.97 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|