C20H32O — CID 15381898
(E,2E)-2-ethylidene-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)oct-5-enal (PubChem CID 15381898) has the molecular formula C20H32O and a molecular weight of 288.47 g/mol. Its IUPAC name is (E,2E)-2-ethylidene-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)oct-5-enal.
| Compound Name | (E,2E)-2-ethylidene-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)oct-5-enal |
|---|---|
| PubChem CID | 15381898 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (E,2E)-2-ethylidene-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)oct-5-enal |
| SMILES | C/C=C(/C=O)CC/C=C(\C)CCC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C20H32O/c1-6-18(15-21)11-7-9-16(2)12-13-19-17(3)10-8-14-20(19,4)5/h6,9,15H,7-8,10-14H2,1-5H3/b16-9+,18-6+ |
| InChIKey | NTGOIJBDHMKCKH-DXHGZJSOSA-N |
| XLogP | 6.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|