C30H46O3 — CID 163046071
(2S)-2-hydroxy-3-[(3E,7E,11E)-4,8,12-trimethyl-14-(2,6,6-trimethylcyclohexen-1-yl)tetradeca-3,7,11-trienyl]-2H-furan-5-one (PubChem CID 163046071) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-[(3E,7E,11E)-4,8,12-trimethyl-14-(2,6,6-trimethylcyclohexen-1-yl)tetradeca-3,7,11-trienyl]-2H-furan-5-one.
| Compound Name | (2S)-2-hydroxy-3-[(3E,7E,11E)-4,8,12-trimethyl-14-(2,6,6-trimethylcyclohexen-1-yl)tetradeca-3,7,11-trienyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 163046071 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | (2S)-2-hydroxy-3-[(3E,7E,11E)-4,8,12-trimethyl-14-(2,6,6-trimethylcyclohexen-1-yl)tetradeca-3,7,11-trienyl]-2H-furan-5-one |
| SMILES | CC1=C(CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CCC2=CC(=O)O[C@@H]2O)C(C)(C)CCC1 |
| InChI | InChI=1S/C30H46O3/c1-22(11-7-12-23(2)15-9-17-26-21-28(31)33-29(26)32)13-8-14-24(3)18-19-27-25(4)16-10-20-30(27,5)6/h11,14-15,21,29,32H,7-10,12-13,16-20H2,1-6H3/b22-11+,23-15+,24-14+/t29-/m0/s1 |
| InChIKey | OJUPTYHGKDPXFU-BDJJGNGBSA-N |
| XLogP | 8.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|