C25H38O5 — CID 163029455
(2R)-3-[(3E,7E)-10-[(1R,5R)-1-acetyl-5-hydroxy-2,2-dimethylcyclopentyl]-4,8-dimethyldeca-3,7-dienyl]-2-hydroxy-2H-furan-5-one (PubChem CID 163029455) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is (2R)-3-[(3E,7E)-10-[(1R,5R)-1-acetyl-5-hydroxy-2,2-dimethylcyclopentyl]-4,8-dimethyldeca-3,7-dienyl]-2-hydroxy-2H-furan-5-one.
| Compound Name | (2R)-3-[(3E,7E)-10-[(1R,5R)-1-acetyl-5-hydroxy-2,2-dimethylcyclopentyl]-4,8-dimethyldeca-3,7-dienyl]-2-hydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 163029455 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | (2R)-3-[(3E,7E)-10-[(1R,5R)-1-acetyl-5-hydroxy-2,2-dimethylcyclopentyl]-4,8-dimethyldeca-3,7-dienyl]-2-hydroxy-2H-furan-5-one |
| SMILES | CC(=O)[C@@]1(CC/C(C)=C/CC/C(C)=C/CCC2=CC(=O)O[C@H]2O)[C@H](O)CCC1(C)C |
| InChI | InChI=1S/C25H38O5/c1-17(10-7-11-20-16-22(28)30-23(20)29)8-6-9-18(2)12-15-25(19(3)26)21(27)13-14-24(25,4)5/h9-10,16,21,23,27,29H,6-8,11-15H2,1-5H3/b17-10+,18-9+/t21-,23-,25+/m1/s1 |
| InChIKey | BDWHNXBIFYPWRV-HZTFXPOSSA-N |
| XLogP | 4.78 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|