C25H37NO4 — CID 163110126
4-hydroxy-2-oxo-7-(4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4,5,7a-tetrahydro-1-benzofuran-3a-carboxamide (PubChem CID 163110126) has the molecular formula C25H37NO4 and a molecular weight of 415.57 g/mol. Its IUPAC name is 4-hydroxy-2-oxo-7-(4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4,5,7a-tetrahydro-1-benzofuran-3a-carboxamide.
| Compound Name | 4-hydroxy-2-oxo-7-(4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4,5,7a-tetrahydro-1-benzofuran-3a-carboxamide |
|---|---|
| PubChem CID | 163110126 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | 4-hydroxy-2-oxo-7-(4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4,5,7a-tetrahydro-1-benzofuran-3a-carboxamide |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC1=CCC(O)C2(C(N)=O)CC(=O)OC12 |
| InChI | InChI=1S/C25H37NO4/c1-17(2)8-5-9-18(3)10-6-11-19(4)12-7-13-20-14-15-21(27)25(24(26)29)16-22(28)30-23(20)25/h8,10,12,14,21,23,27H,5-7,9,11,13,15-16H2,1-4H3,(H2,26,29) |
| InChIKey | JMHANOYCULWORK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|