C20H28O3 — CID 89216286
7-[(2E)-3,7-dimethylocta-2,6-dienyl]-8-methyl-2-oxaspiro[4.5]dec-8-ene-1,3-dione (PubChem CID 89216286) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 7-[(2E)-3,7-dimethylocta-2,6-dienyl]-8-methyl-2-oxaspiro[4.5]dec-8-ene-1,3-dione.
| Compound Name | 7-[(2E)-3,7-dimethylocta-2,6-dienyl]-8-methyl-2-oxaspiro[4.5]dec-8-ene-1,3-dione |
|---|---|
| PubChem CID | 89216286 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 7-[(2E)-3,7-dimethylocta-2,6-dienyl]-8-methyl-2-oxaspiro[4.5]dec-8-ene-1,3-dione |
| SMILES | CC(C)=CCC/C(C)=C/CC1CC2(CC=C1C)CC(=O)OC2=O |
| InChI | InChI=1S/C20H28O3/c1-14(2)6-5-7-15(3)8-9-17-12-20(11-10-16(17)4)13-18(21)23-19(20)22/h6,8,10,17H,5,7,9,11-13H2,1-4H3/b15-8+ |
| InChIKey | WDWHJLSAOAGJJW-OVCLIPMQSA-N |
| XLogP | 4.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|