C24H39NO — CID 91317525
1-[4-methyl-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)-2,3-dihydrofuran-3-yl]pyrrolidine (PubChem CID 91317525) has the molecular formula C24H39NO and a molecular weight of 357.58 g/mol. Its IUPAC name is 1-[4-methyl-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)-2,3-dihydrofuran-3-yl]pyrrolidine.
| Compound Name | 1-[4-methyl-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)-2,3-dihydrofuran-3-yl]pyrrolidine |
|---|---|
| PubChem CID | 91317525 |
| Molecular Formula | C24H39NO |
| Molecular Weight | 357.58 g/mol |
| Exact Mass | 357.30 |
| IUPAC Name | 1-[4-methyl-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)-2,3-dihydrofuran-3-yl]pyrrolidine |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCC1OC=C(C)C1N1CCCC1 |
| InChI | InChI=1S/C24H39NO/c1-19(2)10-8-11-20(3)12-9-13-21(4)14-15-23-24(22(5)18-26-23)25-16-6-7-17-25/h10,12,14,18,23-24H,6-9,11,13,15-17H2,1-5H3 |
| InChIKey | IWDIRMNCVWXGBX-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.58 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|