C30H49NO — CID 118054389
(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyl-1-nitrosotetracosa-2,6,10,14,18,22-hexaene (PubChem CID 118054389) has the molecular formula C30H49NO and a molecular weight of 439.73 g/mol. Its IUPAC name is (2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyl-1-nitrosotetracosa-2,6,10,14,18,22-hexaene.
| Compound Name | (2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyl-1-nitrosotetracosa-2,6,10,14,18,22-hexaene |
|---|---|
| PubChem CID | 118054389 |
| Molecular Formula | C30H49NO |
| Molecular Weight | 439.73 g/mol |
| Exact Mass | 439.38 |
| IUPAC Name | (2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyl-1-nitrosotetracosa-2,6,10,14,18,22-hexaene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CN=O |
| InChI | InChI=1S/C30H49NO/c1-25(2)13-8-14-26(3)15-9-16-27(4)17-10-18-28(5)19-11-20-29(6)21-12-22-30(7)23-24-31-32/h13,15,17,19,21,23H,8-12,14,16,18,20,22,24H2,1-7H3/b26-15+,27-17+,28-19+,29-21+,30-23+ |
| InChIKey | USZSOPFXPVZWSB-MMSZMYIBSA-N |
| XLogP | 10.35 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.73 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|