C15H25NO — CID 54261017
2,6,10-trimethyl-12-nitrosododeca-2,6,9-triene (PubChem CID 54261017) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 2,6,10-trimethyl-12-nitrosododeca-2,6,9-triene.
| Compound Name | 2,6,10-trimethyl-12-nitrosododeca-2,6,9-triene |
|---|---|
| PubChem CID | 54261017 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 2,6,10-trimethyl-12-nitrosododeca-2,6,9-triene |
| SMILES | CC(C)=CCCC(C)=CCC=C(C)CCN=O |
| InChI | InChI=1S/C15H25NO/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16-17/h7,9-10H,5-6,8,11-12H2,1-4H3 |
| InChIKey | RDMYYGCUZPHSIA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|