C18H34 — CID 159897256
methane;(6E,9E)-2,6,10,11,11-pentamethyldodeca-2,6,9-triene (PubChem CID 159897256) has the molecular formula C18H34 and a molecular weight of 250.47 g/mol. Its IUPAC name is methane;(6E,9E)-2,6,10,11,11-pentamethyldodeca-2,6,9-triene.
| Compound Name | methane;(6E,9E)-2,6,10,11,11-pentamethyldodeca-2,6,9-triene |
|---|---|
| PubChem CID | 159897256 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | methane;(6E,9E)-2,6,10,11,11-pentamethyldodeca-2,6,9-triene |
| SMILES | C.CC(C)=CCC/C(C)=C/C/C=C(\C)C(C)(C)C |
| InChI | InChI=1S/C17H30.CH4/c1-14(2)10-8-11-15(3)12-9-13-16(4)17(5,6)7;/h10,12-13H,8-9,11H2,1-7H3;1H4/b15-12+,16-13+; |
| InChIKey | NVMQPJGYFGWUQH-WYGWYXPLSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|