C15H26O — CID 71393329
2,2,6,10-tetramethylundeca-5,9-dien-3-one (PubChem CID 71393329) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is 2,2,6,10-tetramethylundeca-5,9-dien-3-one.
| Compound Name | 2,2,6,10-tetramethylundeca-5,9-dien-3-one |
|---|---|
| PubChem CID | 71393329 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 2,2,6,10-tetramethylundeca-5,9-dien-3-one |
| SMILES | CC(C)=CCCC(C)=CCC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H26O/c1-12(2)8-7-9-13(3)10-11-14(16)15(4,5)6/h8,10H,7,9,11H2,1-6H3 |
| InChIKey | GPDXFQFUDGDKRU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|