C12H19I — CID 173018120
1-iodo-5,9-dimethyldeca-1,4,8-triene (PubChem CID 173018120) has the molecular formula C12H19I and a molecular weight of 290.19 g/mol. Its IUPAC name is 1-iodo-5,9-dimethyldeca-1,4,8-triene.
| Compound Name | 1-iodo-5,9-dimethyldeca-1,4,8-triene |
|---|---|
| PubChem CID | 173018120 |
| Molecular Formula | C12H19I |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 1-iodo-5,9-dimethyldeca-1,4,8-triene |
| SMILES | CC(C)=CCCC(C)=CCC=CI |
| InChI | InChI=1S/C12H19I/c1-11(2)7-6-9-12(3)8-4-5-10-13/h5,7-8,10H,4,6,9H2,1-3H3 |
| InChIKey | SHABXKMIAQJPCF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|